C18H28N2O4 — CID 112975668
N-[2-(3,5-dimethoxyphenoxy)ethyl]-2-ethylpiperidine-1-carboxamide (PubChem CID 112975668) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is N-[2-(3,5-dimethoxyphenoxy)ethyl]-2-ethylpiperidine-1-carboxamide.
| Compound Name | N-[2-(3,5-dimethoxyphenoxy)ethyl]-2-ethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 112975668 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | N-[2-(3,5-dimethoxyphenoxy)ethyl]-2-ethylpiperidine-1-carboxamide |
| SMILES | CCC1CCCCN1C(=O)NCCOc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C18H28N2O4/c1-4-14-7-5-6-9-20(14)18(21)19-8-10-24-17-12-15(22-2)11-16(13-17)23-3/h11-14H,4-10H2,1-3H3,(H,19,21) |
| InChIKey | HYSWXKTVGCMKOK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|