C17H24N2O6 — CID 122006872
1-[2-(3,5-dimethoxyphenoxy)ethylcarbamoyl]piperidine-3-carboxylic acid (PubChem CID 122006872) has the molecular formula C17H24N2O6 and a molecular weight of 352.39 g/mol. Its IUPAC name is 1-[2-(3,5-dimethoxyphenoxy)ethylcarbamoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[2-(3,5-dimethoxyphenoxy)ethylcarbamoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122006872 |
| Molecular Formula | C17H24N2O6 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 1-[2-(3,5-dimethoxyphenoxy)ethylcarbamoyl]piperidine-3-carboxylic acid |
| SMILES | COc1cc(OC)cc(OCCNC(=O)N2CCCC(C(=O)O)C2)c1 |
| InChI | InChI=1S/C17H24N2O6/c1-23-13-8-14(24-2)10-15(9-13)25-7-5-18-17(22)19-6-3-4-12(11-19)16(20)21/h8-10,12H,3-7,11H2,1-2H3,(H,18,22)(H,20,21) |
| InChIKey | XPYUGYPGMDGNBZ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|