C16H18Cl2N2O2S — CID 112980530
N-[4-(butan-2-ylamino)phenyl]-3,4-dichlorobenzenesulfonamide (PubChem CID 112980530) has the molecular formula C16H18Cl2N2O2S and a molecular weight of 373.31 g/mol. Its IUPAC name is N-[4-(butan-2-ylamino)phenyl]-3,4-dichlorobenzenesulfonamide.
| Compound Name | N-[4-(butan-2-ylamino)phenyl]-3,4-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 112980530 |
| Molecular Formula | C16H18Cl2N2O2S |
| Molecular Weight | 373.31 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | N-[4-(butan-2-ylamino)phenyl]-3,4-dichlorobenzenesulfonamide |
| SMILES | CCC(C)Nc1ccc(NS(=O)(=O)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C16H18Cl2N2O2S/c1-3-11(2)19-12-4-6-13(7-5-12)20-23(21,22)14-8-9-15(17)16(18)10-14/h4-11,19-20H,3H2,1-2H3 |
| InChIKey | PBQDYHVCAUPUQU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.31 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |