C10H17NO — CID 11298173
N-octa-1,7-dien-3-ylacetamide (PubChem CID 11298173) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is N-octa-1,7-dien-3-ylacetamide.
| Compound Name | N-octa-1,7-dien-3-ylacetamide |
|---|---|
| PubChem CID | 11298173 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | N-octa-1,7-dien-3-ylacetamide |
| SMILES | C=CCCCC(C=C)NC(C)=O |
| InChI | InChI=1S/C10H17NO/c1-4-6-7-8-10(5-2)11-9(3)12/h4-5,10H,1-2,6-8H2,3H3,(H,11,12) |
| InChIKey | SLVBTCOECHEIJQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|