C14H18N4O2S — CID 112982956
2-[[4-(dimethylsulfamoylamino)anilino]methyl]pyridine (PubChem CID 112982956) has the molecular formula C14H18N4O2S and a molecular weight of 306.39 g/mol. Its IUPAC name is 2-[[4-(dimethylsulfamoylamino)anilino]methyl]pyridine.
| Compound Name | 2-[[4-(dimethylsulfamoylamino)anilino]methyl]pyridine |
|---|---|
| PubChem CID | 112982956 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-[[4-(dimethylsulfamoylamino)anilino]methyl]pyridine |
| SMILES | CN(C)S(=O)(=O)Nc1ccc(NCc2ccccn2)cc1 |
| InChI | InChI=1S/C14H18N4O2S/c1-18(2)21(19,20)17-13-8-6-12(7-9-13)16-11-14-5-3-4-10-15-14/h3-10,16-17H,11H2,1-2H3 |
| InChIKey | XTCHGXPPHJMOTH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |