C14H15N3O2 — CID 43730278
methyl N-[4-(pyridin-2-ylmethylamino)phenyl]carbamate (PubChem CID 43730278) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is methyl N-[4-(pyridin-2-ylmethylamino)phenyl]carbamate.
| Compound Name | methyl N-[4-(pyridin-2-ylmethylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 43730278 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | methyl N-[4-(pyridin-2-ylmethylamino)phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(NCc2ccccn2)cc1 |
| InChI | InChI=1S/C14H15N3O2/c1-19-14(18)17-12-7-5-11(6-8-12)16-10-13-4-2-3-9-15-13/h2-9,16H,10H2,1H3,(H,17,18) |
| InChIKey | JLNITEHJPRXFGO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |