C20H24N2O4S — CID 112984261
N-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenyl]-3-methylbenzenesulfonamide (PubChem CID 112984261) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is N-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenyl]-3-methylbenzenesulfonamide.
| Compound Name | N-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenyl]-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 112984261 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | N-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenyl]-3-methylbenzenesulfonamide |
| SMILES | Cc1cccc(S(=O)(=O)Nc2ccc(N3CCC4(CC3)OCCO4)cc2)c1 |
| InChI | InChI=1S/C20H24N2O4S/c1-16-3-2-4-19(15-16)27(23,24)21-17-5-7-18(8-6-17)22-11-9-20(10-12-22)25-13-14-26-20/h2-8,15,21H,9-14H2,1H3 |
| InChIKey | BKIHFNYZMRAZHS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|