C12H14FN — CID 11298447
(1S,5R,6S)-6-(4-fluorophenyl)-3-azabicyclo[3.2.0]heptane (PubChem CID 11298447) has the molecular formula C12H14FN and a molecular weight of 191.25 g/mol. Its IUPAC name is (1S,5R,6S)-6-(4-fluorophenyl)-3-azabicyclo[3.2.0]heptane.
| Compound Name | (1S,5R,6S)-6-(4-fluorophenyl)-3-azabicyclo[3.2.0]heptane |
|---|---|
| PubChem CID | 11298447 |
| Molecular Formula | C12H14FN |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | (1S,5R,6S)-6-(4-fluorophenyl)-3-azabicyclo[3.2.0]heptane |
| SMILES | Fc1ccc([C@H]2C[C@@H]3CNC[C@@H]32)cc1 |
| InChI | InChI=1S/C12H14FN/c13-10-3-1-8(2-4-10)11-5-9-6-14-7-12(9)11/h1-4,9,11-12,14H,5-7H2/t9-,11-,12+/m1/s1 |
| InChIKey | JKAJCHKORMFKTQ-JLLWLGSASA-N |
| XLogP | 2.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |