C14H17ClFN — CID 20692808
(1S,5R,6S)-3-(2-chloroethyl)-6-(4-fluorophenyl)-3-azabicyclo[3.2.0]heptane (PubChem CID 20692808) has the molecular formula C14H17ClFN and a molecular weight of 253.75 g/mol. Its IUPAC name is (1S,5R,6S)-3-(2-chloroethyl)-6-(4-fluorophenyl)-3-azabicyclo[3.2.0]heptane.
| Compound Name | (1S,5R,6S)-3-(2-chloroethyl)-6-(4-fluorophenyl)-3-azabicyclo[3.2.0]heptane |
|---|---|
| PubChem CID | 20692808 |
| Molecular Formula | C14H17ClFN |
| Molecular Weight | 253.75 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | (1S,5R,6S)-3-(2-chloroethyl)-6-(4-fluorophenyl)-3-azabicyclo[3.2.0]heptane |
| SMILES | Fc1ccc([C@H]2C[C@@H]3CN(CCCl)C[C@@H]32)cc1 |
| InChI | InChI=1S/C14H17ClFN/c15-5-6-17-8-11-7-13(14(11)9-17)10-1-3-12(16)4-2-10/h1-4,11,13-14H,5-9H2/t11-,13-,14+/m1/s1 |
| InChIKey | FFLLXRPCRSGMAF-BNOWGMLFSA-N |
| XLogP | 3.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.75 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|