C22H26N2O3 — CID 112984849
N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)phenyl]cyclobutanecarboxamide (PubChem CID 112984849) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)phenyl]cyclobutanecarboxamide.
| Compound Name | N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)phenyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 112984849 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)phenyl]cyclobutanecarboxamide |
| SMILES | COc1cc2c(cc1OC)CN(c1ccc(NC(=O)C3CCC3)cc1)CC2 |
| InChI | InChI=1S/C22H26N2O3/c1-26-20-12-16-10-11-24(14-17(16)13-21(20)27-2)19-8-6-18(7-9-19)23-22(25)15-4-3-5-15/h6-9,12-13,15H,3-5,10-11,14H2,1-2H3,(H,23,25) |
| InChIKey | PIRQOLGJZXKLLM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|