C22H21ClN2O2 — CID 112985705
N-[4-[2-(3-chlorophenyl)ethylamino]phenyl]-2-methoxybenzamide (PubChem CID 112985705) has the molecular formula C22H21ClN2O2 and a molecular weight of 380.88 g/mol. Its IUPAC name is N-[4-[2-(3-chlorophenyl)ethylamino]phenyl]-2-methoxybenzamide.
| Compound Name | N-[4-[2-(3-chlorophenyl)ethylamino]phenyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 112985705 |
| Molecular Formula | C22H21ClN2O2 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | N-[4-[2-(3-chlorophenyl)ethylamino]phenyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)Nc1ccc(NCCc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C22H21ClN2O2/c1-27-21-8-3-2-7-20(21)22(26)25-19-11-9-18(10-12-19)24-14-13-16-5-4-6-17(23)15-16/h2-12,15,24H,13-14H2,1H3,(H,25,26) |
| InChIKey | LTCWFOUAKCAXFM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |