C10H14F2O2 — CID 11298647
methyl 2-(cyclopentylmethyl)-3,3-difluoroprop-2-enoate (PubChem CID 11298647) has the molecular formula C10H14F2O2 and a molecular weight of 204.22 g/mol. Its IUPAC name is methyl 2-(cyclopentylmethyl)-3,3-difluoroprop-2-enoate.
| Compound Name | methyl 2-(cyclopentylmethyl)-3,3-difluoroprop-2-enoate |
|---|---|
| PubChem CID | 11298647 |
| Molecular Formula | C10H14F2O2 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | methyl 2-(cyclopentylmethyl)-3,3-difluoroprop-2-enoate |
| SMILES | COC(=O)C(CC1CCCC1)=C(F)F |
| InChI | InChI=1S/C10H14F2O2/c1-14-10(13)8(9(11)12)6-7-4-2-3-5-7/h7H,2-6H2,1H3 |
| InChIKey | RCPKGTMRUXOYMP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|