C17H21N3O2S — CID 112989581
1-[4-(dimethylsulfamoylamino)phenyl]-2-methyl-2,3-dihydroindole (PubChem CID 112989581) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is 1-[4-(dimethylsulfamoylamino)phenyl]-2-methyl-2,3-dihydroindole.
| Compound Name | 1-[4-(dimethylsulfamoylamino)phenyl]-2-methyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 112989581 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 1-[4-(dimethylsulfamoylamino)phenyl]-2-methyl-2,3-dihydroindole |
| SMILES | CC1Cc2ccccc2N1c1ccc(NS(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C17H21N3O2S/c1-13-12-14-6-4-5-7-17(14)20(13)16-10-8-15(9-11-16)18-23(21,22)19(2)3/h4-11,13,18H,12H2,1-3H3 |
| InChIKey | PBVCHHBATDHXIU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |