C23H24N2O2S — CID 112989587
N-[4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]-2-phenylethanesulfonamide (PubChem CID 112989587) has the molecular formula C23H24N2O2S and a molecular weight of 392.52 g/mol. Its IUPAC name is N-[4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]-2-phenylethanesulfonamide.
| Compound Name | N-[4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]-2-phenylethanesulfonamide |
|---|---|
| PubChem CID | 112989587 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | N-[4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]-2-phenylethanesulfonamide |
| SMILES | CC1Cc2ccccc2N1c1ccc(NS(=O)(=O)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H24N2O2S/c1-18-17-20-9-5-6-10-23(20)25(18)22-13-11-21(12-14-22)24-28(26,27)16-15-19-7-3-2-4-8-19/h2-14,18,24H,15-17H2,1H3 |
| InChIKey | PLBIWJDDTFKALJ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |