About N-[4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]-2-phenylethanesulfonamide
N-[4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]-2-phenylethanesulfonamide (PubChem CID 112989587) has the molecular formula C23H24N2O2S
and a molecular weight of 392.52 g/mol. Its IUPAC name is N-[4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]-2-phenylethanesulfonamide.
Molecular Properties
| Compound Name | N-[4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]-2-phenylethanesulfonamide |
| PubChem CID | 112989587 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | N-[4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]-2-phenylethanesulfonamide |
| SMILES | CC1Cc2ccccc2N1c1ccc(NS(=O)(=O)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H24N2O2S/c1-18-17-20-9-5-6-10-23(20)25(18)22-13-11-21(12-14-22)24-28(26,27)16-15-19-7-3-2-4-8-19/h2-14,18,24H,15-17H2,1H3 |
| InChIKey | PLBIWJDDTFKALJ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]-2-phenylethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]-2-phenylethanesulfonamide?
The IUPAC name of N-[4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]-2-phenylethanesulfonamide (CID 112989587) is N-[4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]-2-phenylethanesulfonamide.
What is the SMILES notation for N-[4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]-2-phenylethanesulfonamide?
The canonical SMILES for N-[4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]-2-phenylethanesulfonamide is CC1Cc2ccccc2N1c1ccc(NS(=O)(=O)CCc2ccccc2)cc1.
What is the InChIKey of N-[4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]-2-phenylethanesulfonamide?
The InChIKey is PLBIWJDDTFKALJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N2O2S/c1-18-17-20-9-5-6-10-23(20)25(18)22-13-11-21(12-14-22)24-28(26,27)16-15-19-7-3-2-4-8-19/h2-14,18,24H,15-17H2,1H3.
What are the key properties of N-[4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]-2-phenylethanesulfonamide?
N-[4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]-2-phenylethanesulfonamide has a molecular weight of 392.52 g/mol, XLogP of 4.75, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]-2-phenylethanesulfonamide is sourced from PubChem (CID 112989587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).