C13H20O3 — CID 11299058
(3'aS,6'Z,9'aR)-spiro[1,3-dioxolane-2,5'-2,3,4,8,9,9a-hexahydro-1H-cyclopenta[8]annulene]-3'a-ol (PubChem CID 11299058) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is (3'aS,6'Z,9'aR)-spiro[1,3-dioxolane-2,5'-2,3,4,8,9,9a-hexahydro-1H-cyclopenta[8]annulene]-3'a-ol.
| Compound Name | (3'aS,6'Z,9'aR)-spiro[1,3-dioxolane-2,5'-2,3,4,8,9,9a-hexahydro-1H-cyclopenta[8]annulene]-3'a-ol |
|---|---|
| PubChem CID | 11299058 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (3'aS,6'Z,9'aR)-spiro[1,3-dioxolane-2,5'-2,3,4,8,9,9a-hexahydro-1H-cyclopenta[8]annulene]-3'a-ol |
| SMILES | O[C@]12CCC[C@@H]1CC/C=C\C1(C2)OCCO1 |
| InChI | InChI=1S/C13H20O3/c14-12-6-3-5-11(12)4-1-2-7-13(10-12)15-8-9-16-13/h2,7,11,14H,1,3-6,8-10H2/b7-2-/t11-,12-/m0/s1 |
| InChIKey | ZGECTXLYIKICQN-NNUSLRHZSA-N |
| XLogP | 2.00 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|