C16H20O — CID 11299140
(1R,2E)-2-benzylidene-1-prop-2-enylcyclohexan-1-ol (PubChem CID 11299140) has the molecular formula C16H20O and a molecular weight of 228.34 g/mol. Its IUPAC name is (1R,2E)-2-benzylidene-1-prop-2-enylcyclohexan-1-ol.
| Compound Name | (1R,2E)-2-benzylidene-1-prop-2-enylcyclohexan-1-ol |
|---|---|
| PubChem CID | 11299140 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (1R,2E)-2-benzylidene-1-prop-2-enylcyclohexan-1-ol |
| SMILES | C=CC[C@]1(O)CCCC/C1=C\c1ccccc1 |
| InChI | InChI=1S/C16H20O/c1-2-11-16(17)12-7-6-10-15(16)13-14-8-4-3-5-9-14/h2-5,8-9,13,17H,1,6-7,10-12H2/b15-13+/t16-/m0/s1 |
| InChIKey | TZDINCUYEJUVFI-MDJJKAFGSA-N |
| XLogP | 3.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|