C11H18O5 — CID 11299172
(4R,5R)-5-[(1R)-1-(methoxymethoxy)prop-2-enyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde (PubChem CID 11299172) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is (4R,5R)-5-[(1R)-1-(methoxymethoxy)prop-2-enyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde.
| Compound Name | (4R,5R)-5-[(1R)-1-(methoxymethoxy)prop-2-enyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
|---|---|
| PubChem CID | 11299172 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | (4R,5R)-5-[(1R)-1-(methoxymethoxy)prop-2-enyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
| SMILES | C=C[C@@H](OCOC)[C@H]1OC(C)(C)O[C@H]1C=O |
| InChI | InChI=1S/C11H18O5/c1-5-8(14-7-13-4)10-9(6-12)15-11(2,3)16-10/h5-6,8-10H,1,7H2,2-4H3/t8-,9+,10-/m1/s1 |
| InChIKey | BTNIEKFQLKNTCI-KXUCPTDWSA-N |
| XLogP | 0.88 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|