C11H22O5 — CID 11299274
(2S,4R)-4-(2-methoxyethoxymethoxy)hept-6-ene-1,2-diol (PubChem CID 11299274) has the molecular formula C11H22O5 and a molecular weight of 234.29 g/mol. Its IUPAC name is (2S,4R)-4-(2-methoxyethoxymethoxy)hept-6-ene-1,2-diol.
| Compound Name | (2S,4R)-4-(2-methoxyethoxymethoxy)hept-6-ene-1,2-diol |
|---|---|
| PubChem CID | 11299274 |
| Molecular Formula | C11H22O5 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | (2S,4R)-4-(2-methoxyethoxymethoxy)hept-6-ene-1,2-diol |
| SMILES | C=CC[C@H](C[C@H](O)CO)OCOCCOC |
| InChI | InChI=1S/C11H22O5/c1-3-4-11(7-10(13)8-12)16-9-15-6-5-14-2/h3,10-13H,1,4-9H2,2H3/t10-,11+/m0/s1 |
| InChIKey | QRUIAZZOQJITSZ-WDEREUQCSA-N |
| XLogP | 0.31 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|