C18H17F3N2O3 — CID 112998798
N-[2-(2-ethoxyanilino)-2-oxoethyl]-4-(trifluoromethyl)benzamide (PubChem CID 112998798) has the molecular formula C18H17F3N2O3 and a molecular weight of 366.34 g/mol. Its IUPAC name is N-[2-(2-ethoxyanilino)-2-oxoethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-(2-ethoxyanilino)-2-oxoethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 112998798 |
| Molecular Formula | C18H17F3N2O3 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-[2-(2-ethoxyanilino)-2-oxoethyl]-4-(trifluoromethyl)benzamide |
| SMILES | CCOc1ccccc1NC(=O)CNC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H17F3N2O3/c1-2-26-15-6-4-3-5-14(15)23-16(24)11-22-17(25)12-7-9-13(10-8-12)18(19,20)21/h3-10H,2,11H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | UYPNCBBQQVKYRM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |