C19H18F4N2O3 — CID 47898138
N-[2-[2-ethoxy-5-(trifluoromethyl)anilino]-2-oxoethyl]-2-(3-fluorophenyl)acetamide (PubChem CID 47898138) has the molecular formula C19H18F4N2O3 and a molecular weight of 398.36 g/mol. Its IUPAC name is N-[2-[2-ethoxy-5-(trifluoromethyl)anilino]-2-oxoethyl]-2-(3-fluorophenyl)acetamide.
| Compound Name | N-[2-[2-ethoxy-5-(trifluoromethyl)anilino]-2-oxoethyl]-2-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 47898138 |
| Molecular Formula | C19H18F4N2O3 |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | N-[2-[2-ethoxy-5-(trifluoromethyl)anilino]-2-oxoethyl]-2-(3-fluorophenyl)acetamide |
| SMILES | CCOc1ccc(C(F)(F)F)cc1NC(=O)CNC(=O)Cc1cccc(F)c1 |
| InChI | InChI=1S/C19H18F4N2O3/c1-2-28-16-7-6-13(19(21,22)23)10-15(16)25-18(27)11-24-17(26)9-12-4-3-5-14(20)8-12/h3-8,10H,2,9,11H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | DWCNHVVUWDONLK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |