C18H20N2O5S — CID 112999558
N-(3-acetylphenyl)-2-[(4-methoxy-2-methylphenyl)sulfonylamino]acetamide (PubChem CID 112999558) has the molecular formula C18H20N2O5S and a molecular weight of 376.43 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-[(4-methoxy-2-methylphenyl)sulfonylamino]acetamide.
| Compound Name | N-(3-acetylphenyl)-2-[(4-methoxy-2-methylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 112999558 |
| Molecular Formula | C18H20N2O5S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | N-(3-acetylphenyl)-2-[(4-methoxy-2-methylphenyl)sulfonylamino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)NCC(=O)Nc2cccc(C(C)=O)c2)c(C)c1 |
| InChI | InChI=1S/C18H20N2O5S/c1-12-9-16(25-3)7-8-17(12)26(23,24)19-11-18(22)20-15-6-4-5-14(10-15)13(2)21/h4-10,19H,11H2,1-3H3,(H,20,22) |
| InChIKey | UKFTXWQARNEDMF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |