C18H20N2O6S — CID 112999849
methyl 2-[[2-[(4-methoxy-2-methylphenyl)sulfonylamino]acetyl]amino]benzoate (PubChem CID 112999849) has the molecular formula C18H20N2O6S and a molecular weight of 392.43 g/mol. Its IUPAC name is methyl 2-[[2-[(4-methoxy-2-methylphenyl)sulfonylamino]acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[(4-methoxy-2-methylphenyl)sulfonylamino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 112999849 |
| Molecular Formula | C18H20N2O6S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | methyl 2-[[2-[(4-methoxy-2-methylphenyl)sulfonylamino]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)CNS(=O)(=O)c1ccc(OC)cc1C |
| InChI | InChI=1S/C18H20N2O6S/c1-12-10-13(25-2)8-9-16(12)27(23,24)19-11-17(21)20-15-7-5-4-6-14(15)18(22)26-3/h4-10,19H,11H2,1-3H3,(H,20,21) |
| InChIKey | ONBIKGGWJKMELW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |