C12H18N2O5S2 — CID 126840923
N-[dimethyl(oxo)-λ6-sulfanylidene]-2-[(4-methoxy-2-methylphenyl)sulfonylamino]acetamide (PubChem CID 126840923) has the molecular formula C12H18N2O5S2 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-[dimethyl(oxo)-λ6-sulfanylidene]-2-[(4-methoxy-2-methylphenyl)sulfonylamino]acetamide.
| Compound Name | N-[dimethyl(oxo)-λ6-sulfanylidene]-2-[(4-methoxy-2-methylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 126840923 |
| Molecular Formula | C12H18N2O5S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | N-[dimethyl(oxo)-λ6-sulfanylidene]-2-[(4-methoxy-2-methylphenyl)sulfonylamino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)NCC(=O)N=S(C)(C)=O)c(C)c1 |
| InChI | InChI=1S/C12H18N2O5S2/c1-9-7-10(19-2)5-6-11(9)21(17,18)13-8-12(15)14-20(3,4)16/h5-7,13H,8H2,1-4H3 |
| InChIKey | UYIOTJVSNUAKSU-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |