C17H32N2O2 — CID 113005874
1-pentanoyl-N,N-dipropylpiperidine-4-carboxamide (PubChem CID 113005874) has the molecular formula C17H32N2O2 and a molecular weight of 296.45 g/mol. Its IUPAC name is 1-pentanoyl-N,N-dipropylpiperidine-4-carboxamide.
| Compound Name | 1-pentanoyl-N,N-dipropylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 113005874 |
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | 1-pentanoyl-N,N-dipropylpiperidine-4-carboxamide |
| SMILES | CCCCC(=O)N1CCC(C(=O)N(CCC)CCC)CC1 |
| InChI | InChI=1S/C17H32N2O2/c1-4-7-8-16(20)18-13-9-15(10-14-18)17(21)19(11-5-2)12-6-3/h15H,4-14H2,1-3H3 |
| InChIKey | UHLGRYCEDOMGMK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |