C21H22ClFN2O2 — CID 113007362
N-(2-chloro-4,6-dimethylphenyl)-1-(3-fluorobenzoyl)piperidine-4-carboxamide (PubChem CID 113007362) has the molecular formula C21H22ClFN2O2 and a molecular weight of 388.87 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-1-(3-fluorobenzoyl)piperidine-4-carboxamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-1-(3-fluorobenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 113007362 |
| Molecular Formula | C21H22ClFN2O2 |
| Molecular Weight | 388.87 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-1-(3-fluorobenzoyl)piperidine-4-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)C2CCN(C(=O)c3cccc(F)c3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C21H22ClFN2O2/c1-13-10-14(2)19(18(22)11-13)24-20(26)15-6-8-25(9-7-15)21(27)16-4-3-5-17(23)12-16/h3-5,10-12,15H,6-9H2,1-2H3,(H,24,26) |
| InChIKey | SSRVZPGXMNWXCH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.87 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |