C11H8ClF3N2O2 — CID 11300833
2-[3-chloro-4-cyano-N-(2,2,2-trifluoroethyl)anilino]acetic acid (PubChem CID 11300833) has the molecular formula C11H8ClF3N2O2 and a molecular weight of 292.64 g/mol. Its IUPAC name is 2-[3-chloro-4-cyano-N-(2,2,2-trifluoroethyl)anilino]acetic acid.
| Compound Name | 2-[3-chloro-4-cyano-N-(2,2,2-trifluoroethyl)anilino]acetic acid |
|---|---|
| PubChem CID | 11300833 |
| Molecular Formula | C11H8ClF3N2O2 |
| Molecular Weight | 292.64 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 2-[3-chloro-4-cyano-N-(2,2,2-trifluoroethyl)anilino]acetic acid |
| SMILES | N#Cc1ccc(N(CC(=O)O)CC(F)(F)F)cc1Cl |
| InChI | InChI=1S/C11H8ClF3N2O2/c12-9-3-8(2-1-7(9)4-16)17(5-10(18)19)6-11(13,14)15/h1-3H,5-6H2,(H,18,19) |
| InChIKey | ICHVCHDTYGVRMY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.64 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |