C18H18Cl2N2O2S — CID 113008520
N-(3,4-dichlorophenyl)-1-(2-thiophen-2-ylacetyl)piperidine-4-carboxamide (PubChem CID 113008520) has the molecular formula C18H18Cl2N2O2S and a molecular weight of 397.33 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-1-(2-thiophen-2-ylacetyl)piperidine-4-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-1-(2-thiophen-2-ylacetyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 113008520 |
| Molecular Formula | C18H18Cl2N2O2S |
| Molecular Weight | 397.33 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | N-(3,4-dichlorophenyl)-1-(2-thiophen-2-ylacetyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)C1CCN(C(=O)Cc2cccs2)CC1 |
| InChI | InChI=1S/C18H18Cl2N2O2S/c19-15-4-3-13(10-16(15)20)21-18(24)12-5-7-22(8-6-12)17(23)11-14-2-1-9-25-14/h1-4,9-10,12H,5-8,11H2,(H,21,24) |
| InChIKey | HSVXRDMSDYJUDT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.33 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |