C20H20F2N2O2 — CID 113008987
N-(3,4-difluorophenyl)-1-(3-methylbenzoyl)piperidine-4-carboxamide (PubChem CID 113008987) has the molecular formula C20H20F2N2O2 and a molecular weight of 358.39 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-1-(3-methylbenzoyl)piperidine-4-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-1-(3-methylbenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 113008987 |
| Molecular Formula | C20H20F2N2O2 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N-(3,4-difluorophenyl)-1-(3-methylbenzoyl)piperidine-4-carboxamide |
| SMILES | Cc1cccc(C(=O)N2CCC(C(=O)Nc3ccc(F)c(F)c3)CC2)c1 |
| InChI | InChI=1S/C20H20F2N2O2/c1-13-3-2-4-15(11-13)20(26)24-9-7-14(8-10-24)19(25)23-16-5-6-17(21)18(22)12-16/h2-6,11-12,14H,7-10H2,1H3,(H,23,25) |
| InChIKey | UHNOOFBKVJBTRS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |