C16H26O5 — CID 11300988
(2S,3S,4aR,8aR)-6-butyl-2,3-dimethoxy-2,3-dimethyl-8,8a-dihydro-4aH-1,4-benzodioxin-7-one (PubChem CID 11300988) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is (2S,3S,4aR,8aR)-6-butyl-2,3-dimethoxy-2,3-dimethyl-8,8a-dihydro-4aH-1,4-benzodioxin-7-one.
| Compound Name | (2S,3S,4aR,8aR)-6-butyl-2,3-dimethoxy-2,3-dimethyl-8,8a-dihydro-4aH-1,4-benzodioxin-7-one |
|---|---|
| PubChem CID | 11300988 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | (2S,3S,4aR,8aR)-6-butyl-2,3-dimethoxy-2,3-dimethyl-8,8a-dihydro-4aH-1,4-benzodioxin-7-one |
| SMILES | CCCCC1=C[C@H]2O[C@](C)(OC)[C@@](C)(OC)O[C@@H]2CC1=O |
| InChI | InChI=1S/C16H26O5/c1-6-7-8-11-9-13-14(10-12(11)17)21-16(3,19-5)15(2,18-4)20-13/h9,13-14H,6-8,10H2,1-5H3/t13-,14-,15+,16+/m1/s1 |
| InChIKey | HFUJOYLSPQBCPZ-WCVJEAGWSA-N |
| XLogP | 2.59 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |