C20H30Si — CID 11301000
tri(propan-2-yl)-[(Z)-undec-3-en-1,8,10-triynyl]silane (PubChem CID 11301000) has the molecular formula C20H30Si and a molecular weight of 298.55 g/mol. Its IUPAC name is tri(propan-2-yl)-[(Z)-undec-3-en-1,8,10-triynyl]silane.
| Compound Name | tri(propan-2-yl)-[(Z)-undec-3-en-1,8,10-triynyl]silane |
|---|---|
| PubChem CID | 11301000 |
| Molecular Formula | C20H30Si |
| Molecular Weight | 298.55 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | tri(propan-2-yl)-[(Z)-undec-3-en-1,8,10-triynyl]silane |
| SMILES | C#CC#CCCC/C=C\C#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H30Si/c1-8-9-10-11-12-13-14-15-16-17-21(18(2)3,19(4)5)20(6)7/h1,14-15,18-20H,11-13H2,2-7H3/b15-14- |
| InChIKey | WGSBXNCSQXQZQY-PFONDFGASA-N |
| XLogP | 5.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.55 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|