About henicos-19-yn-7-one
henicos-19-yn-7-one (PubChem CID 11301234) has the molecular formula C21H38O
and a molecular weight of 306.53 g/mol. Its IUPAC name is henicos-19-yn-7-one.
Molecular Properties
| Compound Name | henicos-19-yn-7-one |
| PubChem CID | 11301234 |
| Molecular Formula | C21H38O |
| Molecular Weight | 306.53 g/mol |
| Exact Mass | 306.29 |
| IUPAC Name | henicos-19-yn-7-one |
| SMILES | CC#CCCCCCCCCCCCC(=O)CCCCCC |
| InChI | InChI=1S/C21H38O/c1-3-5-7-9-10-11-12-13-14-15-16-18-20-21(22)19-17-8-6-4-2/h4,6-20H2,1-2H3 |
| InChIKey | OROJNSQKQZAQBS-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.53 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze henicos-19-yn-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of henicos-19-yn-7-one?
The IUPAC name of henicos-19-yn-7-one (CID 11301234) is henicos-19-yn-7-one.
What is the SMILES notation for henicos-19-yn-7-one?
The canonical SMILES for henicos-19-yn-7-one is CC#CCCCCCCCCCCCC(=O)CCCCCC.
What is the InChIKey of henicos-19-yn-7-one?
The InChIKey is OROJNSQKQZAQBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H38O/c1-3-5-7-9-10-11-12-13-14-15-16-18-20-21(22)19-17-8-6-4-2/h4,6-20H2,1-2H3.
What are the key properties of henicos-19-yn-7-one?
henicos-19-yn-7-one has a molecular weight of 306.53 g/mol, XLogP of 6.84, 16 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for henicos-19-yn-7-one is sourced from PubChem (CID 11301234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).