C18H19N3O2S2 — CID 113012641
N-[6-[benzyl(ethyl)amino]-3-pyridinyl]thiophene-2-sulfonamide (PubChem CID 113012641) has the molecular formula C18H19N3O2S2 and a molecular weight of 373.50 g/mol. Its IUPAC name is N-[6-[benzyl(ethyl)amino]-3-pyridinyl]thiophene-2-sulfonamide.
| Compound Name | N-[6-[benzyl(ethyl)amino]-3-pyridinyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113012641 |
| Molecular Formula | C18H19N3O2S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | N-[6-[benzyl(ethyl)amino]-3-pyridinyl]thiophene-2-sulfonamide |
| SMILES | CCN(Cc1ccccc1)c1ccc(NS(=O)(=O)c2cccs2)cn1 |
| InChI | InChI=1S/C18H19N3O2S2/c1-2-21(14-15-7-4-3-5-8-15)17-11-10-16(13-19-17)20-25(22,23)18-9-6-12-24-18/h3-13,20H,2,14H2,1H3 |
| InChIKey | JXUGGZKSQXVDAX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |