C19H28N4O4 — CID 113014202
ethyl 4-[[5-(oxane-4-carbonylamino)-2-pyridinyl]amino]piperidine-1-carboxylate (PubChem CID 113014202) has the molecular formula C19H28N4O4 and a molecular weight of 376.46 g/mol. Its IUPAC name is ethyl 4-[[5-(oxane-4-carbonylamino)-2-pyridinyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[5-(oxane-4-carbonylamino)-2-pyridinyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 113014202 |
| Molecular Formula | C19H28N4O4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | ethyl 4-[[5-(oxane-4-carbonylamino)-2-pyridinyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2ccc(NC(=O)C3CCOCC3)cn2)CC1 |
| InChI | InChI=1S/C19H28N4O4/c1-2-27-19(25)23-9-5-15(6-10-23)21-17-4-3-16(13-20-17)22-18(24)14-7-11-26-12-8-14/h3-4,13-15H,2,5-12H2,1H3,(H,20,21)(H,22,24) |
| InChIKey | NAMFDJHSJMYJDE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |