C19H19N5O2 — CID 113014476
N-[6-(4-pyridin-2-ylpiperazin-1-yl)-3-pyridinyl]furan-2-carboxamide (PubChem CID 113014476) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is N-[6-(4-pyridin-2-ylpiperazin-1-yl)-3-pyridinyl]furan-2-carboxamide.
| Compound Name | N-[6-(4-pyridin-2-ylpiperazin-1-yl)-3-pyridinyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 113014476 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | N-[6-(4-pyridin-2-ylpiperazin-1-yl)-3-pyridinyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCN(c3ccccn3)CC2)nc1)c1ccco1 |
| InChI | InChI=1S/C19H19N5O2/c25-19(16-4-3-13-26-16)22-15-6-7-18(21-14-15)24-11-9-23(10-12-24)17-5-1-2-8-20-17/h1-8,13-14H,9-12H2,(H,22,25) |
| InChIKey | WRCSNJWTIZSVTA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |