C18H18N4O4S2 — CID 42691393
N-[6-(4-thiophen-2-ylsulfonylpiperazin-1-yl)-3-pyridinyl]furan-2-carboxamide (PubChem CID 42691393) has the molecular formula C18H18N4O4S2 and a molecular weight of 418.50 g/mol. Its IUPAC name is N-[6-(4-thiophen-2-ylsulfonylpiperazin-1-yl)-3-pyridinyl]furan-2-carboxamide.
| Compound Name | N-[6-(4-thiophen-2-ylsulfonylpiperazin-1-yl)-3-pyridinyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42691393 |
| Molecular Formula | C18H18N4O4S2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | N-[6-(4-thiophen-2-ylsulfonylpiperazin-1-yl)-3-pyridinyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCN(S(=O)(=O)c3cccs3)CC2)nc1)c1ccco1 |
| InChI | InChI=1S/C18H18N4O4S2/c23-18(15-3-1-11-26-15)20-14-5-6-16(19-13-14)21-7-9-22(10-8-21)28(24,25)17-4-2-12-27-17/h1-6,11-13H,7-10H2,(H,20,23) |
| InChIKey | BMSDNQWRCAJWIU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |