C20H27NO2 — CID 11301457
(1S,2R)-2-[[(4-methoxyphenyl)methylamino]methyl]-1-phenylpentan-1-ol (PubChem CID 11301457) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is (1S,2R)-2-[[(4-methoxyphenyl)methylamino]methyl]-1-phenylpentan-1-ol.
| Compound Name | (1S,2R)-2-[[(4-methoxyphenyl)methylamino]methyl]-1-phenylpentan-1-ol |
|---|---|
| PubChem CID | 11301457 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | (1S,2R)-2-[[(4-methoxyphenyl)methylamino]methyl]-1-phenylpentan-1-ol |
| SMILES | CCC[C@H](CNCc1ccc(OC)cc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C20H27NO2/c1-3-7-18(20(22)17-8-5-4-6-9-17)15-21-14-16-10-12-19(23-2)13-11-16/h4-6,8-13,18,20-22H,3,7,14-15H2,1-2H3/t18-,20-/m1/s1 |
| InChIKey | MRYBTPZPQPUGDZ-UYAOXDASSA-N |
| XLogP | 3.93 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |