C17H17F2NO3 — CID 11301669
ethyl 9,10-difluoro-6-methyl-2-oxo-1,6,7,11b-tetrahydrobenzo[a]quinolizine-3-carboxylate (PubChem CID 11301669) has the molecular formula C17H17F2NO3 and a molecular weight of 321.32 g/mol. Its IUPAC name is ethyl 9,10-difluoro-6-methyl-2-oxo-1,6,7,11b-tetrahydrobenzo[a]quinolizine-3-carboxylate.
| Compound Name | ethyl 9,10-difluoro-6-methyl-2-oxo-1,6,7,11b-tetrahydrobenzo[a]quinolizine-3-carboxylate |
|---|---|
| PubChem CID | 11301669 |
| Molecular Formula | C17H17F2NO3 |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | ethyl 9,10-difluoro-6-methyl-2-oxo-1,6,7,11b-tetrahydrobenzo[a]quinolizine-3-carboxylate |
| SMILES | CCOC(=O)C1=CN2C(C)Cc3cc(F)c(F)cc3C2CC1=O |
| InChI | InChI=1S/C17H17F2NO3/c1-3-23-17(22)12-8-20-9(2)4-10-5-13(18)14(19)6-11(10)15(20)7-16(12)21/h5-6,8-9,15H,3-4,7H2,1-2H3 |
| InChIKey | HGMOTJTXURBMGX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|