C16H22O7 — CID 11301819
ethyl 2-[[(2R,3S,6R)-3-acetyloxy-2-(acetyloxymethyl)-3,6-dihydro-2H-pyran-6-yl]methyl]prop-2-enoate (PubChem CID 11301819) has the molecular formula C16H22O7 and a molecular weight of 326.35 g/mol. Its IUPAC name is ethyl 2-[[(2R,3S,6R)-3-acetyloxy-2-(acetyloxymethyl)-3,6-dihydro-2H-pyran-6-yl]methyl]prop-2-enoate.
| Compound Name | ethyl 2-[[(2R,3S,6R)-3-acetyloxy-2-(acetyloxymethyl)-3,6-dihydro-2H-pyran-6-yl]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 11301819 |
| Molecular Formula | C16H22O7 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | ethyl 2-[[(2R,3S,6R)-3-acetyloxy-2-(acetyloxymethyl)-3,6-dihydro-2H-pyran-6-yl]methyl]prop-2-enoate |
| SMILES | C=C(C[C@@H]1C=C[C@H](OC(C)=O)[C@@H](COC(C)=O)O1)C(=O)OCC |
| InChI | InChI=1S/C16H22O7/c1-5-20-16(19)10(2)8-13-6-7-14(22-12(4)18)15(23-13)9-21-11(3)17/h6-7,13-15H,2,5,8-9H2,1,3-4H3/t13-,14-,15+/m0/s1 |
| InChIKey | ZKZZSTSYJPCOKZ-SOUVJXGZSA-N |
| XLogP | 1.31 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|