C19H26O6 — CID 163092781
[(E)-4-[(2R)-4-[(E)-5-acetyloxy-4-methylpent-3-enyl]-5-oxo-2H-furan-2-yl]-3-methylbut-2-enyl] acetate (PubChem CID 163092781) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is [(E)-4-[(2R)-4-[(E)-5-acetyloxy-4-methylpent-3-enyl]-5-oxo-2H-furan-2-yl]-3-methylbut-2-enyl] acetate.
| Compound Name | [(E)-4-[(2R)-4-[(E)-5-acetyloxy-4-methylpent-3-enyl]-5-oxo-2H-furan-2-yl]-3-methylbut-2-enyl] acetate |
|---|---|
| PubChem CID | 163092781 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | [(E)-4-[(2R)-4-[(E)-5-acetyloxy-4-methylpent-3-enyl]-5-oxo-2H-furan-2-yl]-3-methylbut-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)C[C@@H]1C=C(CC/C=C(\C)COC(C)=O)C(=O)O1 |
| InChI | InChI=1S/C19H26O6/c1-13(8-9-23-15(3)20)10-18-11-17(19(22)25-18)7-5-6-14(2)12-24-16(4)21/h6,8,11,18H,5,7,9-10,12H2,1-4H3/b13-8+,14-6+/t18-/m1/s1 |
| InChIKey | YSAVITUVNGFNPS-WWRXGQRBSA-N |
| XLogP | 3.03 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|