C19H14ClF2N3O2 — CID 113021877
2-(4-chlorophenoxy)-N-[6-(2,4-difluoroanilino)-3-pyridinyl]acetamide (PubChem CID 113021877) has the molecular formula C19H14ClF2N3O2 and a molecular weight of 389.79 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[6-(2,4-difluoroanilino)-3-pyridinyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[6-(2,4-difluoroanilino)-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 113021877 |
| Molecular Formula | C19H14ClF2N3O2 |
| Molecular Weight | 389.79 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[6-(2,4-difluoroanilino)-3-pyridinyl]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1)Nc1ccc(Nc2ccc(F)cc2F)nc1 |
| InChI | InChI=1S/C19H14ClF2N3O2/c20-12-1-5-15(6-2-12)27-11-19(26)24-14-4-8-18(23-10-14)25-17-7-3-13(21)9-16(17)22/h1-10H,11H2,(H,23,25)(H,24,26) |
| InChIKey | JBYIANQIDVKTJC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.79 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |