C19H13ClF3N3O — CID 113023060
2-(4-chlorophenyl)-N-[6-(2,3,4-trifluoroanilino)-3-pyridinyl]acetamide (PubChem CID 113023060) has the molecular formula C19H13ClF3N3O and a molecular weight of 391.78 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[6-(2,3,4-trifluoroanilino)-3-pyridinyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[6-(2,3,4-trifluoroanilino)-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 113023060 |
| Molecular Formula | C19H13ClF3N3O |
| Molecular Weight | 391.78 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[6-(2,3,4-trifluoroanilino)-3-pyridinyl]acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)Nc1ccc(Nc2ccc(F)c(F)c2F)nc1 |
| InChI | InChI=1S/C19H13ClF3N3O/c20-12-3-1-11(2-4-12)9-17(27)25-13-5-8-16(24-10-13)26-15-7-6-14(21)18(22)19(15)23/h1-8,10H,9H2,(H,24,26)(H,25,27) |
| InChIKey | YAEYBWIJVFNNCD-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.78 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|