C15H14F3N3O — CID 113023033
N-[6-(2,3,4-trifluoroanilino)-3-pyridinyl]butanamide (PubChem CID 113023033) has the molecular formula C15H14F3N3O and a molecular weight of 309.29 g/mol. Its IUPAC name is N-[6-(2,3,4-trifluoroanilino)-3-pyridinyl]butanamide.
| Compound Name | N-[6-(2,3,4-trifluoroanilino)-3-pyridinyl]butanamide |
|---|---|
| PubChem CID | 113023033 |
| Molecular Formula | C15H14F3N3O |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | N-[6-(2,3,4-trifluoroanilino)-3-pyridinyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(Nc2ccc(F)c(F)c2F)nc1 |
| InChI | InChI=1S/C15H14F3N3O/c1-2-3-13(22)20-9-4-7-12(19-8-9)21-11-6-5-10(16)14(17)15(11)18/h4-8H,2-3H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | XKTCIDMASOXMSU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|