C18H31NO4Si — CID 11302655
[(2R,3S)-1-acetyl-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-3,6-dihydro-2H-pyridin-3-yl] acetate (PubChem CID 11302655) has the molecular formula C18H31NO4Si and a molecular weight of 353.54 g/mol. Its IUPAC name is [(2R,3S)-1-acetyl-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-3,6-dihydro-2H-pyridin-3-yl] acetate.
| Compound Name | [(2R,3S)-1-acetyl-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-3,6-dihydro-2H-pyridin-3-yl] acetate |
|---|---|
| PubChem CID | 11302655 |
| Molecular Formula | C18H31NO4Si |
| Molecular Weight | 353.54 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | [(2R,3S)-1-acetyl-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-3,6-dihydro-2H-pyridin-3-yl] acetate |
| SMILES | C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1[C@@H](OC(C)=O)C=CCN1C(C)=O |
| InChI | InChI=1S/C18H31NO4Si/c1-9-15(23-24(7,8)18(4,5)6)17-16(22-14(3)21)11-10-12-19(17)13(2)20/h9-11,15-17H,1,12H2,2-8H3/t15-,16+,17+/m1/s1 |
| InChIKey | ODNDPMWIQXDAJP-IKGGRYGDSA-N |
| XLogP | 3.28 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|