C15H27NO4Si — CID 10591307
[(1S,4S,5R)-5-acetamido-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl] acetate (PubChem CID 10591307) has the molecular formula C15H27NO4Si and a molecular weight of 313.47 g/mol. Its IUPAC name is [(1S,4S,5R)-5-acetamido-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl] acetate.
| Compound Name | [(1S,4S,5R)-5-acetamido-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 10591307 |
| Molecular Formula | C15H27NO4Si |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | [(1S,4S,5R)-5-acetamido-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl] acetate |
| SMILES | CC(=O)N[C@@H]1[C@@H](OC(C)=O)C=C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H27NO4Si/c1-10(17)16-14-12(19-11(2)18)8-9-13(14)20-21(6,7)15(3,4)5/h8-9,12-14H,1-7H3,(H,16,17)/t12-,13-,14+/m0/s1 |
| InChIKey | OJSQUNBFGCYVPD-MELADBBJSA-N |
| XLogP | 2.38 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|