C26H53NO3SiSn — CID 11467270
N-[(1R,2S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-(tributylstannylmethoxy)cyclopent-3-en-1-yl]acetamide (PubChem CID 11467270) has the molecular formula C26H53NO3SiSn and a molecular weight of 574.51 g/mol. Its IUPAC name is N-[(1R,2S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-(tributylstannylmethoxy)cyclopent-3-en-1-yl]acetamide.
| Compound Name | N-[(1R,2S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-(tributylstannylmethoxy)cyclopent-3-en-1-yl]acetamide |
|---|---|
| PubChem CID | 11467270 |
| Molecular Formula | C26H53NO3SiSn |
| Molecular Weight | 574.51 g/mol |
| Exact Mass | 575.28 |
| IUPAC Name | N-[(1R,2S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-(tributylstannylmethoxy)cyclopent-3-en-1-yl]acetamide |
| SMILES | CCCC[Sn](CCCC)(CCCC)CO[C@H]1C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1NC(C)=O |
| InChI | InChI=1S/C14H26NO3Si.3C4H9.Sn/c1-10(16)15-13-11(17-5)8-9-12(13)18-19(6,7)14(2,3)4;3*1-3-4-2;/h8-9,11-13H,5H2,1-4,6-7H3,(H,15,16);3*1,3-4H2,2H3;/t11-,12-,13+;;;;/m0..../s1 |
| InChIKey | HMUPJXRFZNHIFG-QXHTVVIDSA-N |
| XLogP | 7.22 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.51 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|