C9H15NO3 — CID 10773872
N-[(2R,5S)-2,5-dimethoxycyclopent-3-en-1-yl]acetamide (PubChem CID 10773872) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is N-[(2R,5S)-2,5-dimethoxycyclopent-3-en-1-yl]acetamide.
| Compound Name | N-[(2R,5S)-2,5-dimethoxycyclopent-3-en-1-yl]acetamide |
|---|---|
| PubChem CID | 10773872 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | N-[(2R,5S)-2,5-dimethoxycyclopent-3-en-1-yl]acetamide |
| SMILES | CO[C@H]1C=C[C@@H](OC)C1NC(C)=O |
| InChI | InChI=1S/C9H15NO3/c1-6(11)10-9-7(12-2)4-5-8(9)13-3/h4-5,7-9H,1-3H3,(H,10,11)/t7-,8+,9? |
| InChIKey | BFLULMCCZRJPKD-JVHMLUBASA-N |
| XLogP | 0.09 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|