C11H19NO3 — CID 10536548
[(1S,4R,5S)-4-methoxy-5-(propylamino)cyclopent-2-en-1-yl] acetate (PubChem CID 10536548) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is [(1S,4R,5S)-4-methoxy-5-(propylamino)cyclopent-2-en-1-yl] acetate.
| Compound Name | [(1S,4R,5S)-4-methoxy-5-(propylamino)cyclopent-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 10536548 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | [(1S,4R,5S)-4-methoxy-5-(propylamino)cyclopent-2-en-1-yl] acetate |
| SMILES | CCCN[C@@H]1[C@@H](OC(C)=O)C=C[C@H]1OC |
| InChI | InChI=1S/C11H19NO3/c1-4-7-12-11-9(14-3)5-6-10(11)15-8(2)13/h5-6,9-12H,4,7H2,1-3H3/t9-,10+,11+/m1/s1 |
| InChIKey | HVJCNOOXOQMEQG-VWYCJHECSA-N |
| XLogP | 0.87 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|