C9H13NO4 — CID 10631836
[(1S,4S,5S)-5-acetamido-4-hydroxycyclopent-2-en-1-yl] acetate (PubChem CID 10631836) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is [(1S,4S,5S)-5-acetamido-4-hydroxycyclopent-2-en-1-yl] acetate.
| Compound Name | [(1S,4S,5S)-5-acetamido-4-hydroxycyclopent-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 10631836 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | [(1S,4S,5S)-5-acetamido-4-hydroxycyclopent-2-en-1-yl] acetate |
| SMILES | CC(=O)N[C@@H]1[C@@H](OC(C)=O)C=C[C@@H]1O |
| InChI | InChI=1S/C9H13NO4/c1-5(11)10-9-7(13)3-4-8(9)14-6(2)12/h3-4,7-9,13H,1-2H3,(H,10,11)/t7-,8-,9-/m0/s1 |
| InChIKey | PTLSETDWSXQWKY-CIUDSAMLSA-N |
| XLogP | -0.65 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|