C9H10Cl3NO4 — CID 25259237
[(1R,4S,5S)-4-hydroxy-5-[(2,2,2-trichloroacetyl)amino]cyclopent-2-en-1-yl] acetate (PubChem CID 25259237) has the molecular formula C9H10Cl3NO4 and a molecular weight of 302.54 g/mol. Its IUPAC name is [(1R,4S,5S)-4-hydroxy-5-[(2,2,2-trichloroacetyl)amino]cyclopent-2-en-1-yl] acetate.
| Compound Name | [(1R,4S,5S)-4-hydroxy-5-[(2,2,2-trichloroacetyl)amino]cyclopent-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 25259237 |
| Molecular Formula | C9H10Cl3NO4 |
| Molecular Weight | 302.54 g/mol |
| Exact Mass | 300.97 |
| IUPAC Name | [(1R,4S,5S)-4-hydroxy-5-[(2,2,2-trichloroacetyl)amino]cyclopent-2-en-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C=C[C@H](O)[C@@H]1NC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H10Cl3NO4/c1-4(14)17-6-3-2-5(15)7(6)13-8(16)9(10,11)12/h2-3,5-7,15H,1H3,(H,13,16)/t5-,6+,7-/m0/s1 |
| InChIKey | VZKGTRFYTHNSMD-XVMARJQXSA-N |
| XLogP | 0.70 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.54 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|