C11H15NO5 — CID 10705258
[(1R,4S)-5-acetamido-4-acetyloxycyclopent-2-en-1-yl] acetate (PubChem CID 10705258) has the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. Its IUPAC name is [(1R,4S)-5-acetamido-4-acetyloxycyclopent-2-en-1-yl] acetate.
| Compound Name | [(1R,4S)-5-acetamido-4-acetyloxycyclopent-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 10705258 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | [(1R,4S)-5-acetamido-4-acetyloxycyclopent-2-en-1-yl] acetate |
| SMILES | CC(=O)NC1[C@@H](OC(C)=O)C=C[C@H]1OC(C)=O |
| InChI | InChI=1S/C11H15NO5/c1-6(13)12-11-9(16-7(2)14)4-5-10(11)17-8(3)15/h4-5,9-11H,1-3H3,(H,12,13)/t9-,10+,11? |
| InChIKey | MTQYVHVMNFWMIV-ZACCUICWSA-N |
| XLogP | -0.08 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|